CAS 20479-06-5 is the registry number for beta-Ylangene. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,6R,7R)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decane (CAS 20479-06-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1S,6R,7R)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decane. InChIKey: UPVZPMJSRSWJHQ-KYRRZXGASA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1S,6R,7R)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decane |
| InChIKey | UPVZPMJSRSWJHQ-KYRRZXGASA-N |
| SMILES | CC(C)C1CC[C@]2([C@H]3[C@@H]1C2C(=C)CC3)C |
Computed by PubChem (NCBI)