CAS 1825392-01-5 appears in our catalog under these names: Ethyl 7-chloro-3-hydroxybenzo(b)thiophene-2-carboxylate, 98%, Ethyl 7–chloro–3–hydroxybenzo(b)thiophene–2–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg.
Ethyl 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylate (CAS 1825392-01-5) is a chemical compound with the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. IUPAC name: ethyl 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylate. InChIKey: VVZADVLESMRACU-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | ethyl 7-chloro-3-hydroxy-1-benzothiophene-2-carboxylate |
| InChIKey | VVZADVLESMRACU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)C(=CC=C2)Cl)O |
Computed by PubChem (NCBI)