Products 33851-25-1
CAS 33851-25-1 is the registry number for Ethyl 6-chloro-3-hydroxybenzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 6-chloro-3-hydroxy-1-benzothiophene-2-carboxylate (CAS 33851-25-1) is a chemical compound with the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. IUPAC name: ethyl 6-chloro-3-hydroxy-1-benzothiophene-2-carboxylate. InChIKey: QPQJDGOXMYUFIC-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | ethyl 6-chloro-3-hydroxy-1-benzothiophene-2-carboxylate |
| InChIKey | QPQJDGOXMYUFIC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)