CAS 56875-59-3 appears in our catalog under these names: 6-Methoxynaphthalene-2-sulfonyl chloride, 95%, 6-Methoxy-2-naphthalenesulfonyl Chloride, 6-Methoxynaphthalene-2-sulfonyl chloride, 98+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 100mg, 1g, 500mg, 250mg.
6-methoxynaphthalene-2-sulfonyl chloride (CAS 56875-59-3) is a chemical compound with the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. IUPAC name: 6-methoxynaphthalene-2-sulfonyl chloride. InChIKey: QYCDJXYAIDWYFK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | 6-methoxynaphthalene-2-sulfonyl chloride |
| InChIKey | QYCDJXYAIDWYFK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)