Products 56875-59-3

CAS 56875-59-3 appears in our catalog under these names: 6-Methoxynaphthalene-2-sulfonyl chloride, 95%, 6-Methoxy-2-naphthalenesulfonyl Chloride, 6-Methoxynaphthalene-2-sulfonyl chloride, 98+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 100mg, 1g, 500mg, 250mg.

Structural formula: {0} (CAS {1})

6-methoxynaphthalene-2-sulfonyl chloride (CAS 56875-59-3) is a chemical compound with the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. IUPAC name: 6-methoxynaphthalene-2-sulfonyl chloride. InChIKey: QYCDJXYAIDWYFK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClO3S
Molecular weight256.71 g/mol
IUPAC name6-methoxynaphthalene-2-sulfonyl chloride
InChIKeyQYCDJXYAIDWYFK-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)