Products 56875-60-6

CAS 56875-60-6 appears in our catalog under these names: 7-Methoxynaphthalene-2-sulfonyl chloride, 95%, 7-Methoxynaphthalene-2-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

7-methoxynaphthalene-2-sulfonyl chloride (CAS 56875-60-6) is a chemical compound with the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. IUPAC name: 7-methoxynaphthalene-2-sulfonyl chloride. InChIKey: ZEXCZHWVXMIOFB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClO3S
Molecular weight256.71 g/mol
IUPAC name7-methoxynaphthalene-2-sulfonyl chloride
InChIKeyZEXCZHWVXMIOFB-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)