CAS 56875-60-6 appears in our catalog under these names: 7-Methoxynaphthalene-2-sulfonyl chloride, 95%, 7-Methoxynaphthalene-2-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
7-methoxynaphthalene-2-sulfonyl chloride (CAS 56875-60-6) is a chemical compound with the molecular formula C11H9ClO3S and a molecular weight of 256.71 g/mol. IUPAC name: 7-methoxynaphthalene-2-sulfonyl chloride. InChIKey: ZEXCZHWVXMIOFB-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | 7-methoxynaphthalene-2-sulfonyl chloride |
| InChIKey | ZEXCZHWVXMIOFB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)