Products 1826-28-4
CAS 1826-28-4 appears in our catalog under these names: Phenyl 2-pyridyl ketoxime, 95%, Phenyl 2–Pyridyl Ketoxime, Phenyl 2-Pyridyl Ketoxime, >98.0%(HPLC)(T), Phenyl 2-pyridyl ketoxime, 98%, Methanone, phenyl-2-pyridinyl-, oxime. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 5g.
(NE)-N-[phenyl(pyridin-2-yl)methylidene]hydroxylamine (CAS 1826-28-4) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: (NE)-N-[phenyl(pyridin-2-yl)methylidene]hydroxylamine. InChIKey: RSJDEVMJZLLAHS-WYMLVPIESA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (NE)-N-[phenyl(pyridin-2-yl)methylidene]hydroxylamine |
| InChIKey | RSJDEVMJZLLAHS-WYMLVPIESA-N |
| SMILES | C1=CC=C(C=C1)/C(=N\O)/C2=CC=CC=N2 |
Computed by PubChem (NCBI)
Synonyms:
2-Benzoylpyridine ketoxime, Ketone, phenyl 2-pyridyl, oxime, Methanone, phenyl-2-pyridinyl-, oxime, Ketone, phenyl 2-pyridyl, oxime (8CI), phenyl-2-pyridyl ketoxime, Phenylpyridylketoxime, (E)-phenyl(pyridin-2-yl)methanone oxime, Phenyl(pyridin-2-yl)methanone oxime, (1E)-Phenyl-2-pyridinylmethanone oxime, 2-Benzoylpyridiine ketoxime