CAS 40061-45-8 appears in our catalog under these names: 1-Phenyl-2-pyrazin-2-ylethanone, 95%, 1-Phenyl-2-(pyrazin-2-yl)ethanone, 95+%, 1-Phenyl-2-pyrazin-2-yl ethanone, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-phenyl-2-pyrazin-2-ylethanone (CAS 40061-45-8) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 1-phenyl-2-pyrazin-2-ylethanone. InChIKey: WUYTZBFFXRNJSB-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 1-phenyl-2-pyrazin-2-ylethanone |
| InChIKey | WUYTZBFFXRNJSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=NC=CN=C2 |
Computed by PubChem (NCBI)