CAS 10177-15-8 appears in our catalog under these names: 5-Phenylnicotinamide, 95%, 5–Phenylnicotinamide, 5-phenylpyridine-3-carboxamide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 100mg, 5g, 250mg.
5-phenylpyridine-3-carboxamide (CAS 10177-15-8) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 5-phenylpyridine-3-carboxamide. InChIKey: NKMMJBMWTNPJCV-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5-phenylpyridine-3-carboxamide |
| InChIKey | NKMMJBMWTNPJCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)C(=O)N |
Computed by PubChem (NCBI)