CAS 18109-11-0 is the registry number for 3-(3-Formyl-1h-indol-1-yl)propanenitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g.
3-(3-formylindol-1-yl)propanenitrile (CAS 18109-11-0) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 3-(3-formylindol-1-yl)propanenitrile. InChIKey: UTWRGCLFZOWWSI-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-(3-formylindol-1-yl)propanenitrile |
| InChIKey | UTWRGCLFZOWWSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CCC#N)C=O |
Computed by PubChem (NCBI)