CAS 182677-28-7 is the registry number for 1,1'-Oxybis(2,3,4-tribromo-benzene). Offered by: TRC. Available pack sizes: 100mg.
1,2,3-tribromo-4-(2,3,4-tribromophenoxy)benzene (CAS 182677-28-7) is a chemical compound with the molecular formula C12H4Br6O and a molecular weight of 643.6 g/mol. IUPAC name: 1,2,3-tribromo-4-(2,3,4-tribromophenoxy)benzene. InChIKey: WFLVELCLEGVBIH-UHFFFAOYSA-N.
| Molecular formula | C12H4Br6O |
|---|---|
| Molecular weight | 643.6 g/mol |
| IUPAC name | 1,2,3-tribromo-4-(2,3,4-tribromophenoxy)benzene |
| InChIKey | WFLVELCLEGVBIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC2=C(C(=C(C=C2)Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)