CAS 446254-98-4 is the registry number for Hexabromo-Diphenyl Ether . Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5-pentabromo-6-(2-bromophenoxy)benzene (CAS 446254-98-4) is a chemical compound with the molecular formula C12H4Br6O and a molecular weight of 643.6 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2-bromophenoxy)benzene. InChIKey: LJDGJCNHVGGOFW-UHFFFAOYSA-N.
| Molecular formula | C12H4Br6O |
|---|---|
| Molecular weight | 643.6 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2-bromophenoxy)benzene |
| InChIKey | LJDGJCNHVGGOFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)