CAS 189084-58-0 appears in our catalog under these names: 2,3,4,4,5,6-Hexabromodiphenyl ether, 2,3,4,4',5,6-Hexabromodiphenyl Ether. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,2,3,4,5-pentabromo-6-(4-bromophenoxy)benzene (CAS 189084-58-0) is a chemical compound with the molecular formula C12H4Br6O and a molecular weight of 643.6 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(4-bromophenoxy)benzene. InChIKey: KVYODBMKQYVNEK-UHFFFAOYSA-N.
| Molecular formula | C12H4Br6O |
|---|---|
| Molecular weight | 643.6 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(4-bromophenoxy)benzene |
| InChIKey | KVYODBMKQYVNEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)