CAS 182677-30-1 appears in our catalog under these names: 2,2',3,4,4',5'-Hexabromodiphenyl Ether (BDE138), 2,2',3,4,4',5'-Hexabromodiphenyl Ether, PBDE No. 138. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer. Available pack sizes: on request, 250mg, 500mg, 50mg, 5mg.
1,2,3-tribromo-4-(2,4,5-tribromophenoxy)benzene (CAS 182677-30-1) is a chemical compound with the molecular formula C12H4Br6O and a molecular weight of 643.6 g/mol. IUPAC name: 1,2,3-tribromo-4-(2,4,5-tribromophenoxy)benzene. InChIKey: IZFQCEZFGCMHOM-UHFFFAOYSA-N.
| Molecular formula | C12H4Br6O |
|---|---|
| Molecular weight | 643.6 g/mol |
| IUPAC name | 1,2,3-tribromo-4-(2,4,5-tribromophenoxy)benzene |
| InChIKey | IZFQCEZFGCMHOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC2=CC(=C(C=C2Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)