Products 1826827-36-4

CAS 1826827-36-4 is the registry number for 3-(3-Carboxyphenoxy)phthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3-carboxyphenoxy)phthalic acid (CAS 1826827-36-4) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 302.23 g/mol. IUPAC name: 3-(3-carboxyphenoxy)phthalic acid. InChIKey: LDMUZWAPSNRHJN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10O7
Molecular weight302.23 g/mol
IUPAC name3-(3-carboxyphenoxy)phthalic acid
InChIKeyLDMUZWAPSNRHJN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC2=CC=CC(=C2C(=O)O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)