Products 263711-79-1
CAS 263711-79-1 appears in our catalog under these names: Quercetin-d3 (Major), >95% (HPLC), Quercetin-d3, 98.73%. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
3,5,7-trihydroxy-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)chromen-4-one (CAS 263711-79-1) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 305.25 g/mol. IUPAC name: 3,5,7-trihydroxy-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)chromen-4-one. InChIKey: REFJWTPEDVJJIY-CBYSEHNBSA-N.
| Molecular formula | C15H10O7 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 3,5,7-trihydroxy-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)chromen-4-one |
| InChIKey | REFJWTPEDVJJIY-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)[2H])O)O)[2H] |
Computed by PubChem (NCBI)