Products 263711-78-0
CAS 263711-78-0 appears in our catalog under these names: Quercetin D5, Quercetin-d5. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 5 mg, 1 mg.
6,8-dideuterio-3,5,7-trihydroxy-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)chromen-4-one (CAS 263711-78-0) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 307.27 g/mol. IUPAC name: 6,8-dideuterio-3,5,7-trihydroxy-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)chromen-4-one. InChIKey: REFJWTPEDVJJIY-RALIUCGRSA-N.
| Molecular formula | C15H10O7 |
|---|---|
| Molecular weight | 307.27 g/mol |
| IUPAC name | 6,8-dideuterio-3,5,7-trihydroxy-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)chromen-4-one |
| InChIKey | REFJWTPEDVJJIY-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C(=O)C3=C(C(=C(C(=C3O2)[2H])O)[2H])O)O)[2H])O)O)[2H] |
Computed by PubChem (NCBI)