CAS 489-58-7 is the registry number for 3,7,8,3',4'-Pentahydroxyflavone. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1mg, 5mg.
2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxychromen-4-one (CAS 489-58-7) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 302.23 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxychromen-4-one. InChIKey: RHTZDFORBKRGQU-UHFFFAOYSA-N.
| Molecular formula | C15H10O7 |
|---|---|
| Molecular weight | 302.23 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxychromen-4-one |
| InChIKey | RHTZDFORBKRGQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3)O)O)O)O)O |
Computed by PubChem (NCBI)