Products 1826882-12-5

CAS 1826882-12-5 is the registry number for 4-Carboxy-Mephedrone Hydrochloride. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

4-[2-(methylamino)propanoyl]benzoic acid;hydrochloride (CAS 1826882-12-5) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 4-[2-(methylamino)propanoyl]benzoic acid;hydrochloride. InChIKey: IUMNINNRIBRZKU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO3
Molecular weight243.68 g/mol
IUPAC name4-[2-(methylamino)propanoyl]benzoic acid;hydrochloride
InChIKeyIUMNINNRIBRZKU-UHFFFAOYSA-N
SMILESCC(C(=O)C1=CC=C(C=C1)C(=O)O)NC.Cl

Computed by PubChem (NCBI)