Products 1828197-59-6
CAS 1828197-59-6 is the registry number for 1-(3,4-Difluorobenzyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3,4-difluorophenyl)methyl]pyrrolidine-3-carboxylic acid (CAS 1828197-59-6) is a chemical compound with the molecular formula C12H13F2NO2 and a molecular weight of 241.23 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]pyrrolidine-3-carboxylic acid. InChIKey: VVWGVDKQEDXDEX-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO2 |
|---|---|
| Molecular weight | 241.23 g/mol |
| IUPAC name | 1-[(3,4-difluorophenyl)methyl]pyrrolidine-3-carboxylic acid |
| InChIKey | VVWGVDKQEDXDEX-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)