Products 1830312-37-2
CAS 1830312-37-2 appears in our catalog under these names: 4-Chloro-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine, 95%, 4-Chloro-6-(Trifluoromethyl)-7H-Pyrrolo[2,3-D]Pyrimidine, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-chloro-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine (CAS 1830312-37-2) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 4-chloro-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: NAKVHEWRZBCYMW-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 4-chloro-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | NAKVHEWRZBCYMW-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1C(=NC=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)