Products 1835670-60-4

CAS 1835670-60-4 is the registry number for 1-​Ethyl-​1,​3-​dihydro-​2,​1,​3-​benzothiadiazole 2,​2-​dioxide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-ethyl-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide (CAS 1835670-60-4) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 3-ethyl-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide. InChIKey: ADAYVPNTCLDKIV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2S
Molecular weight198.24 g/mol
IUPAC name3-ethyl-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide
InChIKeyADAYVPNTCLDKIV-UHFFFAOYSA-N
SMILESCCN1C2=CC=CC=C2NS1(=O)=O

Computed by PubChem (NCBI)