Products 183607-06-9
CAS 183607-06-9 is the registry number for rac-tert-Butyl N-((3R,4R)-3-hydroxy-1,1-dioxo-1λ6-thian-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[(3R,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate (CAS 183607-06-9) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate. InChIKey: UVSJWPKERWLXIO-SFYZADRCSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate |
| InChIKey | UVSJWPKERWLXIO-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCS(=O)(=O)C[C@@H]1O |
Computed by PubChem (NCBI)