Products 18372-16-2

CAS 18372-16-2 is the registry number for DL-Indole-3-lactic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-3-(1H-indol-3-yl)propanoate (CAS 18372-16-2) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: methyl 2-hydroxy-3-(1H-indol-3-yl)propanoate. InChIKey: YHKXBTJWCNPFQV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO3
Molecular weight219.24 g/mol
IUPAC namemethyl 2-hydroxy-3-(1H-indol-3-yl)propanoate
InChIKeyYHKXBTJWCNPFQV-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CNC2=CC=CC=C21)O

Computed by PubChem (NCBI)