Products 183732-21-0
CAS 183732-21-0 appears in our catalog under these names: (R)-4-(4-Hydroxybenzyl)oxazolidine-2,5-dione, 95%, 95%, 2,5-Oxazolidinedione, 4-[(4-hydroxyphenyl)methyl]-, (R)-, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
(4R)-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidine-2,5-dione (CAS 183732-21-0) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: (4R)-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidine-2,5-dione. InChIKey: HOEAPYNDVBABMC-MRVPVSSYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | (4R)-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidine-2,5-dione |
| InChIKey | HOEAPYNDVBABMC-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H]2C(=O)OC(=O)N2)O |
Computed by PubChem (NCBI)