CAS 183801-93-6 is the registry number for 5-Bromoquinoxalin-2-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-1H-quinoxalin-2-one (CAS 183801-93-6) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-1H-quinoxalin-2-one. InChIKey: NNMWNRZCGSHFKY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-1H-quinoxalin-2-one |
| InChIKey | NNMWNRZCGSHFKY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=CC(=O)N2 |
Computed by PubChem (NCBI)