Products 183990-46-7
CAS 183990-46-7 appears in our catalog under these names: 8-(2-Hydroxybenzamido)octanoic acid, 95%, Salcaprozic Acid, 8–(2–hydroxybenzamido)octanoic acid, 8-(2-Hydroxybenzamido)octanoic acid 97%, 8-(2-Hydroxybenzamido)octanoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, on request, 25g, 5g, 100g, 10g, 50g.
8-[(2-hydroxybenzoyl)amino]octanoic acid (CAS 183990-46-7) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 8-[(2-hydroxybenzoyl)amino]octanoic acid. InChIKey: NJEKDCUDSORUJA-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 8-[(2-hydroxybenzoyl)amino]octanoic acid |
| InChIKey | NJEKDCUDSORUJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)O)O |
Computed by PubChem (NCBI)