Products 1841099-11-3

CAS 1841099-11-3 is the registry number for (2R)-2-amino-3-(1-methylcyclobutyl)propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-(1-methylcyclobutyl)propanoic acid (CAS 1841099-11-3) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (2R)-2-amino-3-(1-methylcyclobutyl)propanoic acid. InChIKey: BMMSEIZQWPNKMW-ZCFIWIBFSA-N.

Identity
Molecular formulaC8H15NO2
Molecular weight157.21 g/mol
IUPAC name(2R)-2-amino-3-(1-methylcyclobutyl)propanoic acid
InChIKeyBMMSEIZQWPNKMW-ZCFIWIBFSA-N
SMILESCC1(CCC1)C[C@H](C(=O)O)N

Computed by PubChem (NCBI)