Products 1844992-13-7
CAS 1844992-13-7 appears in our catalog under these names: (2S)–2–Amino–3–(1–methylcyclobutyl)propanoic acid, (2S)-2-amino-3-(1-methylcyclobutyl)propanoic acid, 97%, 97%, (2S)-2-AMINO-3-(1-METHYLCYCLOBUTYL)PROPANOIC ACID, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(2S)-2-amino-3-(1-methylcyclobutyl)propanoic acid (CAS 1844992-13-7) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (2S)-2-amino-3-(1-methylcyclobutyl)propanoic acid. InChIKey: BMMSEIZQWPNKMW-LURJTMIESA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-methylcyclobutyl)propanoic acid |
| InChIKey | BMMSEIZQWPNKMW-LURJTMIESA-N |
| SMILES | CC1(CCC1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)