Products 1849185-75-6

CAS 1849185-75-6 is the registry number for 2–Amino–3–(1–methylcyclobutyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-amino-3-(1-methylcyclobutyl)propanoic acid (CAS 1849185-75-6) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: 2-amino-3-(1-methylcyclobutyl)propanoic acid. InChIKey: BMMSEIZQWPNKMW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO2
Molecular weight157.21 g/mol
IUPAC name2-amino-3-(1-methylcyclobutyl)propanoic acid
InChIKeyBMMSEIZQWPNKMW-UHFFFAOYSA-N
SMILESCC1(CCC1)CC(C(=O)O)N

Computed by PubChem (NCBI)