CAS 1843368-38-6 appears in our catalog under these names: Safinamide Impurity 11, (S)-2-((4-hydroxybenzyl)amino)propanamide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 25mg, 50mg.
(2S)-2-[(4-hydroxyphenyl)methylamino]propanamide (CAS 1843368-38-6) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: (2S)-2-[(4-hydroxyphenyl)methylamino]propanamide. InChIKey: SSYMBBYRHLZBTD-ZETCQYMHSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | (2S)-2-[(4-hydroxyphenyl)methylamino]propanamide |
| InChIKey | SSYMBBYRHLZBTD-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)N)NCC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)