Products 18437-63-3
CAS 18437-63-3 appears in our catalog under these names: tert-Butyl 4-nitrophenylcarbamate, 97%, tert-Butyl (4-nitrophenyl)carbamate 97%, tert-Butyl (4-nitrophenyl)carbamate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g.
Tert-butyl N-(4-nitrophenyl)carbamate (CAS 18437-63-3) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: tert-butyl N-(4-nitrophenyl)carbamate. InChIKey: XZBFRRXPMQLVPL-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | tert-butyl N-(4-nitrophenyl)carbamate |
| InChIKey | XZBFRRXPMQLVPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)