Products 18450-28-7

CAS 18450-28-7 is the registry number for Ethyl 3-Formyl-1-methyl-1H-indole-2-carboxylate. Offered by: TRC, Biosynth. Available pack sizes: 10g, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 3-formyl-1-methylindole-2-carboxylate (CAS 18450-28-7) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 3-formyl-1-methylindole-2-carboxylate. InChIKey: BZNCZFAUVNDYFF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO3
Molecular weight231.25 g/mol
IUPAC nameethyl 3-formyl-1-methylindole-2-carboxylate
InChIKeyBZNCZFAUVNDYFF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=CC=CC=C2N1C)C=O

Computed by PubChem (NCBI)