CAS 1845715-32-3 is the registry number for N-Methyl 4-Acetamido-2-methylbenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[3-methyl-4-(methylsulfamoyl)phenyl]acetamide (CAS 1845715-32-3) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: N-[3-methyl-4-(methylsulfamoyl)phenyl]acetamide. InChIKey: OTMQOVBBIQJCKG-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | N-[3-methyl-4-(methylsulfamoyl)phenyl]acetamide |
| InChIKey | OTMQOVBBIQJCKG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C)S(=O)(=O)NC |
Computed by PubChem (NCBI)