CAS 18474-59-4 appears in our catalog under these names: 6-Methyl-1H-indole-2-carboxylic acid, 98%, eIF4A3–IN–8, eIF4A3-IN-8 98%, 6-Methyl-1H-indole-2-carboxylic acid, 98%, 98%, eIF4A3-IN-8, 99.98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg, 500mg, 10mM/1mL.
6-methyl-1H-indole-2-carboxylic acid (CAS 18474-59-4) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 6-methyl-1H-indole-2-carboxylic acid. InChIKey: ZKGSVVHFMZASJS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 6-methyl-1H-indole-2-carboxylic acid |
| InChIKey | ZKGSVVHFMZASJS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)