CAS 1847487-56-2 appears in our catalog under these names: Asenapine Impurity 6 (Deschloro Asenapine), Deschloro Acenapine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 75mg.
(2S,6S)-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene (CAS 1847487-56-2) is a chemical compound with the molecular formula C17H17NO and a molecular weight of 251.32 g/mol. IUPAC name: (2S,6S)-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene. InChIKey: ZGNIVYPANONZHS-HUUCEWRRSA-N.
| Molecular formula | C17H17NO |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | (2S,6S)-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaene |
| InChIKey | ZGNIVYPANONZHS-HUUCEWRRSA-N |
| SMILES | CN1C[C@H]2[C@H](C1)C3=CC=CC=C3OC4=CC=CC=C24 |
Computed by PubChem (NCBI)