Products 1848979-91-8
CAS 1848979-91-8 is the registry number for Methyl 2-(4-nitro-3-(phenylthio)phenyl)-2-phenylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Methyl 2-(4-nitro-3-phenylsulfanylphenyl)-2-phenylacetate (CAS 1848979-91-8) is a chemical compound with the molecular formula C21H17NO4S and a molecular weight of 379.4 g/mol. IUPAC name: methyl 2-(4-nitro-3-phenylsulfanylphenyl)-2-phenylacetate. InChIKey: DIQRSJCWDRRMNB-UHFFFAOYSA-N.
| Molecular formula | C21H17NO4S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | methyl 2-(4-nitro-3-phenylsulfanylphenyl)-2-phenylacetate |
| InChIKey | DIQRSJCWDRRMNB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1)C2=CC(=C(C=C2)[N+](=O)[O-])SC3=CC=CC=C3 |
Computed by PubChem (NCBI)