CAS 476362-75-1 is the registry number for 5-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]thiophene-2-carboxylic acid (CAS 476362-75-1) is a chemical compound with the molecular formula C21H17NO4S and a molecular weight of 379.4 g/mol. IUPAC name: 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]thiophene-2-carboxylic acid. InChIKey: FTPSFRLVPGNHGC-UHFFFAOYSA-N.
| Molecular formula | C21H17NO4S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]thiophene-2-carboxylic acid |
| InChIKey | FTPSFRLVPGNHGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(S4)C(=O)O |
Computed by PubChem (NCBI)