CAS 211682-13-2 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(thiophen-2-yl)acetic acid, 98%, Fmoc-(S)-2-thienylglycine, 98%, Fmoc–D–(2–thienyl)glycine, Fmoc-(S)-2-thienylglycine, 98%, 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-thiophen-2-ylacetic acid (CAS 211682-13-2) is a chemical compound with the molecular formula C21H17NO4S and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-thiophen-2-ylacetic acid. InChIKey: DOQXSEXNUPRHPV-LJQANCHMSA-N.
| Molecular formula | C21H17NO4S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-thiophen-2-ylacetic acid |
| InChIKey | DOQXSEXNUPRHPV-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=CC=CS4)C(=O)O |
Computed by PubChem (NCBI)