Products 211682-11-0

CAS 211682-11-0 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(thiophen-2-yl)amino)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-thiophen-2-ylacetic acid (CAS 211682-11-0) is a chemical compound with the molecular formula C21H17NO4S and a molecular weight of 379.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-thiophen-2-ylacetic acid. InChIKey: DOQXSEXNUPRHPV-UHFFFAOYSA-N.

Identity
Molecular formulaC21H17NO4S
Molecular weight379.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-thiophen-2-ylacetic acid
InChIKeyDOQXSEXNUPRHPV-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC=CS4)C(=O)O

Computed by PubChem (NCBI)