CAS 18492-10-9 is the registry number for 1-(β-D-Xylofuranosyl)-5-methylcytosine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 1 mg.
4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one (CAS 18492-10-9) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one. InChIKey: ZAYHVCMSTBRABG-JVZYCSMKSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| InChIKey | ZAYHVCMSTBRABG-JVZYCSMKSA-N |
| SMILES | CC1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)