CAS 185030-09-5 appears in our catalog under these names: (R)-2-(Cyclopent-1-en-1-yl)-2-hydroxy-2-phenylacetic acid, 95%, Glycopyrrolate Impurity 31, (R)-2-(Cyclopent-1-en-1-yl)-2-hydroxy-2-phenylacetic acid 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: 250mg, 100mg, on request, 1g, 5g.
(2R)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetic acid (CAS 185030-09-5) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetic acid. InChIKey: ATRKPHAUYCRSSD-ZDUSSCGKSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-2-(cyclopenten-1-yl)-2-hydroxy-2-phenylacetic acid |
| InChIKey | ATRKPHAUYCRSSD-ZDUSSCGKSA-N |
| SMILES | C1CC=C(C1)[C@@](C2=CC=CC=C2)(C(=O)O)O |
Computed by PubChem (NCBI)