Products 185114-94-7
CAS 185114-94-7 appears in our catalog under these names: (3R,4S,5S,6R)–6–(acetoxymethyl)–4–azidotetrahydro–2H–pyran–2,3,5–triyl triacetate, 1,2,4,6-Tetra-O-acetyl-3-azido-3-deoxy-D-glucopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 2g, 500mg, 5g.
[(2R,3S,4S,5R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate (CAS 185114-94-7) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3S,4S,5R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate. InChIKey: LJICGUPPWNZTFT-DYPLGBCKSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-3,5,6-triacetyloxy-4-azidooxan-2-yl]methyl acetate |
| InChIKey | LJICGUPPWNZTFT-DYPLGBCKSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](C(O1)OC(=O)C)OC(=O)C)N=[N+]=[N-])OC(=O)C |
Computed by PubChem (NCBI)