Products 94427-00-6

CAS 94427-00-6 is the registry number for 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl Azide. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1000mg, 500mg, 2000mg.

Structural formula: {0} (CAS {1})

[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate (CAS 94427-00-6) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate. InChIKey: NHNYHKRWHCWHAJ-HTOAHKCRSA-N.

Identity
Molecular formulaC14H19N3O9
Molecular weight373.32 g/mol
IUPAC name[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate
InChIKeyNHNYHKRWHCWHAJ-HTOAHKCRSA-N
SMILESCC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)