CAS 94427-00-6 is the registry number for 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl Azide. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1000mg, 500mg, 2000mg.
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate (CAS 94427-00-6) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate. InChIKey: NHNYHKRWHCWHAJ-HTOAHKCRSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate |
| InChIKey | NHNYHKRWHCWHAJ-HTOAHKCRSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)