CAS 13992-25-1 appears in our catalog under these names: 1-Azido-1-deoxy-b-D-glucopyranoside tetraacetate, 98%, 1-Azido-1-deoxy-β-D-glucopyranoside tetraacetate, 98%, 98%, 2,3,4,6–Tetra–O–acetyl–β–D–galactopyranosyl Azide, 2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl azide. Offered by: Fluorochem, Chemat, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5000mg, 2000mg, 10g, 2g, 5g.
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate (CAS 13992-25-1) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate. InChIKey: NHNYHKRWHCWHAJ-RKQHYHRCSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate |
| InChIKey | NHNYHKRWHCWHAJ-RKQHYHRCSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)