CAS 65864-60-0 appears in our catalog under these names: 2,3,4,6–Tetra–O–acetyl–β–D–mannopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-β-D-mannopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-beta-D-mannopyranosyl Azide, ≥98%, ≥98%, 2,3,4,6-Tetra-O-acetyl-β-D-mannopyranosyl azide. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 0,5g, 2g, 10g, 5g, 50mg, 250mg, Get quote.
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate (CAS 65864-60-0) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate. InChIKey: NHNYHKRWHCWHAJ-PEBLQZBPSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetate |
| InChIKey | NHNYHKRWHCWHAJ-PEBLQZBPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)