Products 2892200-78-9
CAS 2892200-78-9 appears in our catalog under these names: 5-(10,11-Dihydro-5H-dibenz(b,f)azepin-5-yl)-1,4-benzenedicarboxylic acid, 5-(10,11-Dihydro-5H-dibenz[b,f]azepin-5-yl)-1,3-benzenedicarboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 5g, 100mg, 250mg.
5-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)benzene-1,3-dicarboxylic acid (CAS 2892200-78-9) is a chemical compound with the molecular formula C22H17NO4 and a molecular weight of 359.4 g/mol. IUPAC name: 5-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)benzene-1,3-dicarboxylic acid. InChIKey: CXYGIYYPHMWTDV-UHFFFAOYSA-N.
| Molecular formula | C22H17NO4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 5-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | CXYGIYYPHMWTDV-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C3=CC=CC=C31)C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)