CAS 500579-03-3 is the registry number for 2-(2,5-Dimethoxyphenyl)benzo(g)quinoline-4-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(2,5-dimethoxyphenyl)benzo[g]quinoline-4-carboxylic acid (CAS 500579-03-3) is a chemical compound with the molecular formula C22H17NO4 and a molecular weight of 359.4 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)benzo[g]quinoline-4-carboxylic acid. InChIKey: ZCLXWKXUYMPGDQ-UHFFFAOYSA-N.
| Molecular formula | C22H17NO4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)benzo[g]quinoline-4-carboxylic acid |
| InChIKey | ZCLXWKXUYMPGDQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=NC3=CC4=CC=CC=C4C=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)