CAS 1851335-55-1 is the registry number for 2-Chloro-4-fluoro-3-methoxybenzoyl chloride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-chloro-4-fluoro-3-methoxybenzoyl chloride (CAS 1851335-55-1) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 2-chloro-4-fluoro-3-methoxybenzoyl chloride. InChIKey: GKEJHQNCGVYRTP-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 2-chloro-4-fluoro-3-methoxybenzoyl chloride |
| InChIKey | GKEJHQNCGVYRTP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)