Products 18515-05-4
CAS 18515-05-4 is the registry number for 1-(1,1-Dimethylethyl)-2-methoxy-3-nitrobenzene, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-tert-butyl-2-methoxy-3-nitrobenzene (CAS 18515-05-4) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 1-tert-butyl-2-methoxy-3-nitrobenzene. InChIKey: HFDDPCHLAKYZGV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 1-tert-butyl-2-methoxy-3-nitrobenzene |
| InChIKey | HFDDPCHLAKYZGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)