CAS 1851912-12-3 appears in our catalog under these names: 2-Chloro-7,7-dimethyl-5H,7H-furo(3,4-b)pyridine-3-carbonitrile, 95%, 2-Chloro-7,7-dimethyl-5H,7H-furo(3,4-b)pyridine-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridine-3-carbonitrile (CAS 1851912-12-3) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridine-3-carbonitrile. InChIKey: QSPACLUVDBOXSR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridine-3-carbonitrile |
| InChIKey | QSPACLUVDBOXSR-UHFFFAOYSA-N |
| SMILES | CC1(C2=NC(=C(C=C2CO1)C#N)Cl)C |
Computed by PubChem (NCBI)